C22H37IN6OS — CID 111011624
1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111011624) has the molecular formula C22H37IN6OS and a molecular weight of 560.55 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111011624 |
| Molecular Formula | C22H37IN6OS |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C22H36N6OS.HI/c1-5-23-22(24-15-19-17(2)26-28(18(19)3)12-13-29-4)25-16-20(21-9-8-14-30-21)27-10-6-7-11-27;/h8-9,14,20H,5-7,10-13,15-16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | FPBJWZSHENERAI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|