C15H29N5O2 — CID 110939838
1-ethyl-3-(2-methoxyethyl)-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine (PubChem CID 110939838) has the molecular formula C15H29N5O2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyethyl)-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-methoxyethyl)-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 110939838 |
| Molecular Formula | C15H29N5O2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | 1-ethyl-3-(2-methoxyethyl)-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCCOC |
| InChI | InChI=1S/C15H29N5O2/c1-6-16-15(17-7-9-21-4)18-11-14-12(2)19-20(13(14)3)8-10-22-5/h6-11H2,1-5H3,(H2,16,17,18) |
| InChIKey | CKJYPUKPWDOTQM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|