C23H37N5O2 — CID 111640716
1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[3-(4-methoxyphenyl)butyl]guanidine (PubChem CID 111640716) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[3-(4-methoxyphenyl)butyl]guanidine.
| Compound Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[3-(4-methoxyphenyl)butyl]guanidine |
|---|---|
| PubChem CID | 111640716 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[3-(4-methoxyphenyl)butyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCCC(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H37N5O2/c1-7-24-23(25-13-12-17(2)20-8-10-21(30-6)11-9-20)26-16-22-18(3)27-28(19(22)4)14-15-29-5/h8-11,17H,7,12-16H2,1-6H3,(H2,24,25,26) |
| InChIKey | FCOIGMPNCOGVTD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|