C24H40N6O — CID 111010669
1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine (PubChem CID 111010669) has the molecular formula C24H40N6O and a molecular weight of 428.63 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine.
| Compound Name | 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111010669 |
| Molecular Formula | C24H40N6O |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCC(c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C24H40N6O/c1-7-25-24(26-17-22-19(4)28-30(20(22)5)15-16-31-6)27-18-23(29(8-2)9-3)21-13-11-10-12-14-21/h10-14,23H,7-9,15-18H2,1-6H3,(H2,25,26,27) |
| InChIKey | OGMCEAMKKRLOMO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|