C19H28N8O — CID 111013839
1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111013839) has the molecular formula C19H28N8O and a molecular weight of 384.49 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111013839 |
| Molecular Formula | C19H28N8O |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H28N8O/c1-5-20-19(22-13-18-24-23-17-8-6-7-9-26(17)18)21-12-16-14(2)25-27(15(16)3)10-11-28-4/h6-9H,5,10-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | WNBOXNUGBVJCBO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|