C19H28N8 — CID 109401055
2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 109401055) has the molecular formula C19H28N8 and a molecular weight of 368.49 g/mol. Its IUPAC name is 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109401055 |
| Molecular Formula | C19H28N8 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H28N8/c1-5-15-14(16(6-2)26(4)25-15)12-21-19(20-7-3)22-13-18-24-23-17-10-8-9-11-27(17)18/h8-11H,5-7,12-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | PUSNZYYPEBSLOG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|