C19H22N8 — CID 111015759
1-ethyl-2-[(1-methylbenzimidazol-2-yl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111015759) has the molecular formula C19H22N8 and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-ethyl-2-[(1-methylbenzimidazol-2-yl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-2-[(1-methylbenzimidazol-2-yl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111015759 |
| Molecular Formula | C19H22N8 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-ethyl-2-[(1-methylbenzimidazol-2-yl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nc2ccccc2n1C)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H22N8/c1-3-20-19(22-13-18-25-24-16-10-6-7-11-27(16)18)21-12-17-23-14-8-4-5-9-15(14)26(17)2/h4-11H,3,12-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | UNBWXNKDXAYJCJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|