C18H26IN7S — CID 111014058
2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014058) has the molecular formula C18H26IN7S and a molecular weight of 499.43 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014058 |
| Molecular Formula | C18H26IN7S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(C(C)(C)C)n1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H25N7S.HI/c1-5-19-17(20-10-13-12-26-16(22-13)18(2,3)4)21-11-15-24-23-14-8-6-7-9-25(14)15;/h6-9,12H,5,10-11H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | QVKYRRLHHPFRNS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|