C15H17F3IN7S — CID 111617043
1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111617043) has the molecular formula C15H17F3IN7S and a molecular weight of 511.32 g/mol. Its IUPAC name is 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111617043 |
| Molecular Formula | C15H17F3IN7S |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H16F3N7S.HI/c1-2-19-14(21-8-13-22-10(9-26-13)15(16,17)18)20-7-12-24-23-11-5-3-4-6-25(11)12;/h3-6,9H,2,7-8H2,1H3,(H2,19,20,21);1H |
| InChIKey | UAONKMZBFDQROL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|