C17H23N7S — CID 111014715
1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111014715) has the molecular formula C17H23N7S and a molecular weight of 357.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111014715 |
| Molecular Formula | C17H23N7S |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCc1csc(CC)n1 |
| InChI | InChI=1S/C17H23N7S/c1-3-16-21-13(12-25-16)8-9-19-17(18-4-2)20-11-15-23-22-14-7-5-6-10-24(14)15/h5-7,10,12H,3-4,8-9,11H2,1-2H3,(H2,18,19,20) |
| InChIKey | SYVVQEZIQZZIEB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|