C21H29IN6S — CID 111850723
1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111850723) has the molecular formula C21H29IN6S and a molecular weight of 524.48 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111850723 |
| Molecular Formula | C21H29IN6S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCCc1csc(CC)n1.I |
| InChI | InChI=1S/C21H28N6S.HI/c1-3-20-26-19(16-28-20)10-12-23-21(22-4-2)24-14-17-8-5-6-9-18(17)15-27-13-7-11-25-27;/h5-9,11,13,16H,3-4,10,12,14-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | IUIYIMFPVAJKOY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|