C18H26IN7S — CID 111015808
1-ethyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015808) has the molecular formula C18H26IN7S and a molecular weight of 499.43 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015808 |
| Molecular Formula | C18H26IN7S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 1-ethyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCCCc1nc(C)cs1.I |
| InChI | InChI=1S/C18H25N7S.HI/c1-3-19-18(20-10-6-4-9-17-22-14(2)13-26-17)21-12-16-24-23-15-8-5-7-11-25(15)16;/h5,7-8,11,13H,3-4,6,9-10,12H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | UTVKIUWXPFJOJL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|