C20H28IN7S — CID 111015822
1-ethyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015822) has the molecular formula C20H28IN7S and a molecular weight of 525.46 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015822 |
| Molecular Formula | C20H28IN7S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 1-ethyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCCc1nc2c(s1)CCCC2.I |
| InChI | InChI=1S/C20H27N7S.HI/c1-2-21-20(23-14-18-26-25-17-10-5-6-13-27(17)18)22-12-7-11-19-24-15-8-3-4-9-16(15)28-19;/h5-6,10,13H,2-4,7-9,11-12,14H2,1H3,(H2,21,22,23);1H |
| InChIKey | PLHBEHBAXNYLMF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|