C18H27N5S2 — CID 111525166
1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine (PubChem CID 111525166) has the molecular formula C18H27N5S2 and a molecular weight of 377.58 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111525166 |
| Molecular Formula | C18H27N5S2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCCc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C18H27N5S2/c1-3-19-18(22-12-17-21-11-13(2)24-17)20-10-6-9-16-23-14-7-4-5-8-15(14)25-16/h11H,3-10,12H2,1-2H3,(H2,19,20,22) |
| InChIKey | YBCULLSHUPUKAZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|