C17H25IN4S — CID 111512219
1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111512219) has the molecular formula C17H25IN4S and a molecular weight of 444.39 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111512219 |
| Molecular Formula | C17H25IN4S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(3-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCCc1ccccc1.I |
| InChI | InChI=1S/C17H24N4S.HI/c1-3-18-17(21-13-16-20-12-14(2)22-16)19-11-7-10-15-8-5-4-6-9-15;/h4-6,8-9,12H,3,7,10-11,13H2,1-2H3,(H2,18,19,21);1H |
| InChIKey | SCVXRKKARDKMSG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|