C17H26N6S — CID 111523523
1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 111523523) has the molecular formula C17H26N6S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 111523523 |
| Molecular Formula | C17H26N6S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCCCNc1ccccn1 |
| InChI | InChI=1S/C17H26N6S/c1-3-18-17(23-13-16-22-12-14(2)24-16)21-11-7-6-10-20-15-8-4-5-9-19-15/h4-5,8-9,12H,3,6-7,10-11,13H2,1-2H3,(H,19,20)(H2,18,21,23) |
| InChIKey | ZIALOPMOUVHNOD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|