C13H21IN6S — CID 111525371
1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(2-pyrazol-1-ylethyl)guanidine;hydroiodide (PubChem CID 111525371) has the molecular formula C13H21IN6S and a molecular weight of 420.32 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(2-pyrazol-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(2-pyrazol-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111525371 |
| Molecular Formula | C13H21IN6S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(2-pyrazol-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCn1cccn1.I |
| InChI | InChI=1S/C13H20N6S.HI/c1-3-14-13(15-6-8-19-7-4-5-18-19)17-10-12-16-9-11(2)20-12;/h4-5,7,9H,3,6,8,10H2,1-2H3,(H2,14,15,17);1H |
| InChIKey | FSIBKASULGLFIW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|