C12H21IN4O2S — CID 111525321
methyl 3-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111525321) has the molecular formula C12H21IN4O2S and a molecular weight of 412.30 g/mol. Its IUPAC name is methyl 3-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111525321 |
| Molecular Formula | C12H21IN4O2S |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | methyl 3-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCC(=O)OC.I |
| InChI | InChI=1S/C12H20N4O2S.HI/c1-4-13-12(14-6-5-11(17)18-3)16-8-10-15-7-9(2)19-10;/h7H,4-6,8H2,1-3H3,(H2,13,14,16);1H |
| InChIKey | CSOAVXYSVWOMKT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|