C18H29IN8S — CID 111523246
1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111523246) has the molecular formula C18H29IN8S and a molecular weight of 516.46 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111523246 |
| Molecular Formula | C18H29IN8S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 1-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C18H28N8S.HI/c1-3-19-17(24-14-16-23-13-15(2)27-16)20-7-8-25-9-11-26(12-10-25)18-21-5-4-6-22-18;/h4-6,13H,3,7-12,14H2,1-2H3,(H2,19,20,24);1H |
| InChIKey | UEAMWIXTYGEVSU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|