C20H33N9 — CID 111952513
1-ethyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111952513) has the molecular formula C20H33N9 and a molecular weight of 399.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111952513 |
| Molecular Formula | C20H33N9 |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 1-ethyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H33N9/c1-5-21-19(25-15-18-16(2)26-27(4)17(18)3)22-9-10-28-11-13-29(14-12-28)20-23-7-6-8-24-20/h6-8H,5,9-15H2,1-4H3,(H2,21,22,25) |
| InChIKey | XQVAUPIDOGTWMX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|