C25H42IN7 — CID 111951494
1-ethyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111951494) has the molecular formula C25H42IN7 and a molecular weight of 567.56 g/mol. Its IUPAC name is 1-ethyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111951494 |
| Molecular Formula | C25H42IN7 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 1-ethyl-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCCCN1CCN(c2cccc(C)c2)CC1.I |
| InChI | InChI=1S/C25H41N7.HI/c1-6-26-25(28-19-24-21(3)29-30(5)22(24)4)27-12-7-8-13-31-14-16-32(17-15-31)23-11-9-10-20(2)18-23;/h9-11,18H,6-8,12-17,19H2,1-5H3,(H2,26,27,28);1H |
| InChIKey | KCJYZFUEGKBWOH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|