C25H46IN5O — CID 111712234
1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine;hydroiodide (PubChem CID 111712234) has the molecular formula C25H46IN5O and a molecular weight of 559.58 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111712234 |
| Molecular Formula | C25H46IN5O |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]guanidine;hydroiodide |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCCCN1CCN(c2cccc(C)c2)CC1.I |
| InChI | InChI=1S/C25H45N5O.HI/c1-4-9-23(12-19-31)21-28-25(26-5-2)27-13-6-7-14-29-15-17-30(18-16-29)24-11-8-10-22(3)20-24;/h8,10-11,20,23,31H,4-7,9,12-19,21H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | AXJPHHPGJCMICC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|