C20H36IN3O — CID 111713104
1-[2-(2,4-dimethylphenyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide (PubChem CID 111713104) has the molecular formula C20H36IN3O and a molecular weight of 461.43 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-dimethylphenyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111713104 |
| Molecular Formula | C20H36IN3O |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCc1ccc(C)cc1C.I |
| InChI | InChI=1S/C20H35N3O.HI/c1-5-7-18(11-13-24)15-23-20(21-6-2)22-12-10-19-9-8-16(3)14-17(19)4;/h8-9,14,18,24H,5-7,10-13,15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | BIDVLVYBTFKPDQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|