C22H40IN3O3 — CID 111712624
1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide (PubChem CID 111712624) has the molecular formula C22H40IN3O3 and a molecular weight of 521.48 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111712624 |
| Molecular Formula | C22H40IN3O3 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCc1ccc(OCC)c(OCC)c1.I |
| InChI | InChI=1S/C22H39N3O3.HI/c1-5-9-19(13-15-26)17-25-22(23-6-2)24-14-12-18-10-11-20(27-7-3)21(16-18)28-8-4;/h10-11,16,19,26H,5-9,12-15,17H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | NULNAGACLRNBMA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|