C22H37IN4O — CID 111715607
1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111715607) has the molecular formula C22H37IN4O and a molecular weight of 500.47 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111715607 |
| Molecular Formula | C22H37IN4O |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCc1c[nH]c2cc(C)ccc12.I |
| InChI | InChI=1S/C22H36N4O.HI/c1-5-23-22(26-14-18(9-11-27)12-16(2)3)24-10-8-19-15-25-21-13-17(4)6-7-20(19)21;/h6-7,13,15-16,18,25,27H,5,8-12,14H2,1-4H3,(H2,23,24,26);1H |
| InChIKey | HLQMZRDKFQJNTC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|