C22H40IN3O4 — CID 111715156
1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111715156) has the molecular formula C22H40IN3O4 and a molecular weight of 537.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111715156 |
| Molecular Formula | C22H40IN3O4 |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCc1ccc(OC)c(OC)c1OC.I |
| InChI | InChI=1S/C22H39N3O4.HI/c1-7-23-22(25-15-17(11-13-26)14-16(2)3)24-12-10-18-8-9-19(27-4)21(29-6)20(18)28-5;/h8-9,16-17,26H,7,10-15H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | WOVDGOTWDOUMHQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|