C20H29FIN7 — CID 111233078
1-ethyl-2-[(4-fluorophenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111233078) has the molecular formula C20H29FIN7 and a molecular weight of 513.40 g/mol. Its IUPAC name is 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111233078 |
| Molecular Formula | C20H29FIN7 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C20H28FN7.HI/c1-2-22-19(26-16-17-4-6-18(21)7-5-17)23-10-11-27-12-14-28(15-13-27)20-24-8-3-9-25-20;/h3-9H,2,10-16H2,1H3,(H2,22,23,26);1H |
| InChIKey | GAYQKTMSMFGTNL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|