C22H33FIN7 — CID 111845412
1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111845412) has the molecular formula C22H33FIN7 and a molecular weight of 541.46 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111845412 |
| Molecular Formula | C22H33FIN7 |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)c(F)c1)NCCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C22H32FN7.HI/c1-3-24-21(28-17-19-7-6-18(2)20(23)16-19)25-10-5-11-29-12-14-30(15-13-29)22-26-8-4-9-27-22;/h4,6-9,16H,3,5,10-15,17H2,1-2H3,(H2,24,25,28);1H |
| InChIKey | YRDVIKTVIAYHKF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|