C21H30ClN7 — CID 111176394
2-[(3-chlorophenyl)methyl]-1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111176394) has the molecular formula C21H30ClN7 and a molecular weight of 415.97 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111176394 |
| Molecular Formula | C21H30ClN7 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(Cl)c1)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H30ClN7/c1-2-23-20(27-17-18-6-3-7-19(22)16-18)24-10-5-11-28-12-14-29(15-13-28)21-25-8-4-9-26-21/h3-4,6-9,16H,2,5,10-15,17H2,1H3,(H2,23,24,27) |
| InChIKey | CLOIWDKPGPCCRG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|