C22H30F3N7 — CID 111268551
1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111268551) has the molecular formula C22H30F3N7 and a molecular weight of 449.53 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111268551 |
| Molecular Formula | C22H30F3N7 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H30F3N7/c1-2-26-20(30-17-18-6-3-7-19(16-18)22(23,24)25)27-10-5-11-31-12-14-32(15-13-31)21-28-8-4-9-29-21/h3-4,6-9,16H,2,5,10-15,17H2,1H3,(H2,26,27,30) |
| InChIKey | SEQZBEINJNTZNX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|