C15H22F3N3 — CID 111152142
1-butyl-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111152142) has the molecular formula C15H22F3N3 and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-butyl-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-butyl-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111152142 |
| Molecular Formula | C15H22F3N3 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-butyl-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCCCN/C(=N/Cc1cccc(C(F)(F)F)c1)NCC |
| InChI | InChI=1S/C15H22F3N3/c1-3-5-9-20-14(19-4-2)21-11-12-7-6-8-13(10-12)15(16,17)18/h6-8,10H,3-5,9,11H2,1-2H3,(H2,19,20,21) |
| InChIKey | MRBBWGZCSBMMJU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|