C17H26F3N3O2S — CID 111573883
1-(2-tert-butylsulfonylethyl)-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111573883) has the molecular formula C17H26F3N3O2S and a molecular weight of 393.48 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111573883 |
| Molecular Formula | C17H26F3N3O2S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C17H26F3N3O2S/c1-5-21-15(22-9-10-26(24,25)16(2,3)4)23-12-13-7-6-8-14(11-13)17(18,19)20/h6-8,11H,5,9-10,12H2,1-4H3,(H2,21,22,23) |
| InChIKey | BRXLRZAJGOFKJD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|