C20H25F3IN3O2S — CID 111267486
1-ethyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111267486) has the molecular formula C20H25F3IN3O2S and a molecular weight of 555.40 g/mol. Its IUPAC name is 1-ethyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111267486 |
| Molecular Formula | C20H25F3IN3O2S |
| Molecular Weight | 555.40 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | 1-ethyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1ccc(CS(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C20H24F3N3O2S.HI/c1-3-24-19(26-13-17-5-4-6-18(11-17)20(21,22)23)25-12-15-7-9-16(10-8-15)14-29(2,27)28;/h4-11H,3,12-14H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | HBSMQJQDCIPXIK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|