C24H29F3N4O — CID 111267793
1-ethyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111267793) has the molecular formula C24H29F3N4O and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-ethyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111267793 |
| Molecular Formula | C24H29F3N4O |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 1-ethyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29F3N4O/c1-2-28-23(30-17-19-7-6-8-21(15-19)24(25,26)27)29-16-18-9-11-20(12-10-18)22(32)31-13-4-3-5-14-31/h6-12,15H,2-5,13-14,16-17H2,1H3,(H2,28,29,30) |
| InChIKey | DKPHCPOGXKXXML-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|