C21H25F4IN4O — CID 111268454
N-[2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111268454) has the molecular formula C21H25F4IN4O and a molecular weight of 552.35 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111268454 |
| Molecular Formula | C21H25F4IN4O |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCNC(=O)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C21H24F4N4O.HI/c1-2-26-20(29-14-16-6-3-7-17(11-16)21(23,24)25)28-10-9-27-19(30)13-15-5-4-8-18(22)12-15;/h3-8,11-12H,2,9-10,13-14H2,1H3,(H,27,30)(H2,26,28,29);1H |
| InChIKey | KUNLDELUTVYCSE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|