C20H22ClF3N4O — CID 111267791
2-chloro-N-[2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111267791) has the molecular formula C20H22ClF3N4O and a molecular weight of 426.87 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111267791 |
| Molecular Formula | C20H22ClF3N4O |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-chloro-N-[2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H22ClF3N4O/c1-2-25-19(28-13-14-6-5-7-15(12-14)20(22,23)24)27-11-10-26-18(29)16-8-3-4-9-17(16)21/h3-9,12H,2,10-11,13H2,1H3,(H,26,29)(H2,25,27,28) |
| InChIKey | PGCVDASADGZVFK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|