C19H20ClF3N4O — CID 111268209
2-chloro-N-[2-[[N'-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111268209) has the molecular formula C19H20ClF3N4O and a molecular weight of 412.84 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N'-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N'-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111268209 |
| Molecular Formula | C19H20ClF3N4O |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-chloro-N-[2-[[N'-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1Cl)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20ClF3N4O/c1-24-18(27-12-13-5-4-6-14(11-13)19(21,22)23)26-10-9-25-17(28)15-7-2-3-8-16(15)20/h2-8,11H,9-10,12H2,1H3,(H,25,28)(H2,24,26,27) |
| InChIKey | XJVRTVAYKWKNQZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|