C17H18F3N3 — CID 110953874
1-benzyl-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 110953874) has the molecular formula C17H18F3N3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 1-benzyl-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-benzyl-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110953874 |
| Molecular Formula | C17H18F3N3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-benzyl-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3/c1-21-16(22-11-13-6-3-2-4-7-13)23-12-14-8-5-9-15(10-14)17(18,19)20/h2-10H,11-12H2,1H3,(H2,21,22,23) |
| InChIKey | CAVPZADEIUVFGM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|