C19H23F3N4O2S — CID 111268135
2-methyl-1-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111268135) has the molecular formula C19H23F3N4O2S and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-methyl-1-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111268135 |
| Molecular Formula | C19H23F3N4O2S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-methyl-1-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(CS(=O)(=O)NC)c1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H23F3N4O2S/c1-23-18(26-12-15-6-4-8-17(10-15)19(20,21)22)25-11-14-5-3-7-16(9-14)13-29(27,28)24-2/h3-10,24H,11-13H2,1-2H3,(H2,23,25,26) |
| InChIKey | CHORKBYSABHTRP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|