C19H23ClFIN4O — CID 111853231
2-chloro-N-[2-[[N-[(4-fluoro-3-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111853231) has the molecular formula C19H23ClFIN4O and a molecular weight of 504.78 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-[(4-fluoro-3-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 2-chloro-N-[2-[[N-[(4-fluoro-3-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111853231 |
| Molecular Formula | C19H23ClFIN4O |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 2-chloro-N-[2-[[N-[(4-fluoro-3-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1Cl)NCc1ccc(F)c(C)c1.I |
| InChI | InChI=1S/C19H22ClFN4O.HI/c1-13-11-14(7-8-17(13)21)12-25-19(22-2)24-10-9-23-18(26)15-5-3-4-6-16(15)20;/h3-8,11H,9-10,12H2,1-2H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | ZCLICMWSMUXEMS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|