C12H18FN3 — CID 111853632
1-ethyl-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine (PubChem CID 111853632) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-ethyl-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-ethyl-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111853632 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 1-ethyl-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine |
| SMILES | CCN/C(=N\C)NCc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C12H18FN3/c1-4-15-12(14-3)16-8-10-5-6-11(13)9(2)7-10/h5-7H,4,8H2,1-3H3,(H2,14,15,16) |
| InChIKey | YDGWHLADQWCDJX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|