C15H24FN3 — CID 111002673
1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine (PubChem CID 111002673) has the molecular formula C15H24FN3 and a molecular weight of 265.38 g/mol. Its IUPAC name is 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine.
| Compound Name | 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 111002673 |
| Molecular Formula | C15H24FN3 |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine |
| SMILES | C/N=C(/NCc1ccc(F)c(C)c1)NC(C)C(C)C |
| InChI | InChI=1S/C15H24FN3/c1-10(2)12(4)19-15(17-5)18-9-13-6-7-14(16)11(3)8-13/h6-8,10,12H,9H2,1-5H3,(H2,17,18,19) |
| InChIKey | DOECPCLKACXTEZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|