C19H23F2N3O — CID 111714104
1-[(4-fluoro-3-methylphenyl)methyl]-3-[2-(4-fluorophenyl)-2-methoxyethyl]-2-methylguanidine (PubChem CID 111714104) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-[(4-fluoro-3-methylphenyl)methyl]-3-[2-(4-fluorophenyl)-2-methoxyethyl]-2-methylguanidine.
| Compound Name | 1-[(4-fluoro-3-methylphenyl)methyl]-3-[2-(4-fluorophenyl)-2-methoxyethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111714104 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[(4-fluoro-3-methylphenyl)methyl]-3-[2-(4-fluorophenyl)-2-methoxyethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(F)c(C)c1)NCC(OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23F2N3O/c1-13-10-14(4-9-17(13)21)11-23-19(22-2)24-12-18(25-3)15-5-7-16(20)8-6-15/h4-10,18H,11-12H2,1-3H3,(H2,22,23,24) |
| InChIKey | YDFCQISPGWCYCT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|