C19H22ClFN4O — CID 111265729
2-chloro-N-[2-[[N-ethyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111265729) has the molecular formula C19H22ClFN4O and a molecular weight of 376.86 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-ethyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-ethyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111265729 |
| Molecular Formula | C19H22ClFN4O |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-chloro-N-[2-[[N-ethyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H22ClFN4O/c1-2-22-19(25-13-14-7-3-6-10-17(14)21)24-12-11-23-18(26)15-8-4-5-9-16(15)20/h3-10H,2,11-13H2,1H3,(H,23,26)(H2,22,24,25) |
| InChIKey | VLICDWDZUFSNLN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|