C19H29FN4O — CID 111266017
N-[2-[[N-ethyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]cyclohexanecarboxamide (PubChem CID 111266017) has the molecular formula C19H29FN4O and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 111266017 |
| Molecular Formula | C19H29FN4O |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]cyclohexanecarboxamide |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H29FN4O/c1-2-21-19(24-14-16-10-6-7-11-17(16)20)23-13-12-22-18(25)15-8-4-3-5-9-15/h6-7,10-11,15H,2-5,8-9,12-14H2,1H3,(H,22,25)(H2,21,23,24) |
| InChIKey | QASQJXAUVYSSLM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|