C20H25ClFIN4O — CID 111174830
N-[2-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111174830) has the molecular formula C20H25ClFIN4O and a molecular weight of 518.80 g/mol. Its IUPAC name is N-[2-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111174830 |
| Molecular Formula | C20H25ClFIN4O |
| Molecular Weight | 518.80 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | N-[2-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCCNC(=O)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C20H24ClFN4O.HI/c1-2-23-20(26-14-16-5-3-4-6-18(16)21)25-12-11-24-19(27)13-15-7-9-17(22)10-8-15;/h3-10H,2,11-14H2,1H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | ZPEHPZACWSXZHN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|