C20H25ClN4O — CID 111175497
N-[3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]benzamide (PubChem CID 111175497) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is N-[3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]benzamide.
| Compound Name | N-[3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111175497 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25ClN4O/c1-2-22-20(25-15-17-11-6-7-12-18(17)21)24-14-8-13-23-19(26)16-9-4-3-5-10-16/h3-7,9-12H,2,8,13-15H2,1H3,(H,23,26)(H2,22,24,25) |
| InChIKey | PJYRURFIEZTGAC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|