C15H25ClIN3S — CID 111627503
2-[(2-chlorophenyl)methyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111627503) has the molecular formula C15H25ClIN3S and a molecular weight of 441.81 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111627503 |
| Molecular Formula | C15H25ClIN3S |
| Molecular Weight | 441.81 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCCCCSC.I |
| InChI | InChI=1S/C15H24ClN3S.HI/c1-3-17-15(18-10-6-7-11-20-2)19-12-13-8-4-5-9-14(13)16;/h4-5,8-9H,3,6-7,10-12H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | PDPKPBMIWBDXSL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|