C16H25ClF3IN4 — CID 111173993
2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111173993) has the molecular formula C16H25ClF3IN4 and a molecular weight of 492.76 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111173993 |
| Molecular Formula | C16H25ClF3IN4 |
| Molecular Weight | 492.76 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCCCN(C)CC(F)(F)F.I |
| InChI | InChI=1S/C16H24ClF3N4.HI/c1-3-21-15(23-11-13-7-4-5-8-14(13)17)22-9-6-10-24(2)12-16(18,19)20;/h4-5,7-8H,3,6,9-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | ZSKOIPJRBDLHPQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|