C16H27ClN4O2S — CID 111175257
2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine (PubChem CID 111175257) has the molecular formula C16H27ClN4O2S and a molecular weight of 374.94 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111175257 |
| Molecular Formula | C16H27ClN4O2S |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCCCN(CC)S(C)(=O)=O |
| InChI | InChI=1S/C16H27ClN4O2S/c1-4-18-16(20-13-14-9-6-7-10-15(14)17)19-11-8-12-21(5-2)24(3,22)23/h6-7,9-10H,4-5,8,11-13H2,1-3H3,(H2,18,19,20) |
| InChIKey | VEXHBSAQTHFOGI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|